C26H28Cl2N6O3 — CID 44565629
N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-[2-(dimethylamino)ethoxy]-4-(N,N-dimethylcarbamimidoyl)benzamide (PubChem CID 44565629) has the molecular formula C26H28Cl2N6O3 and a molecular weight of 543.46 g/mol. Its IUPAC name is N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-[2-(dimethylamino)ethoxy]-4-(N,N-dimethylcarbamimidoyl)benzamide.
| Compound Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-[2-(dimethylamino)ethoxy]-4-(N,N-dimethylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 44565629 |
| Molecular Formula | C26H28Cl2N6O3 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-[2-(dimethylamino)ethoxy]-4-(N,N-dimethylcarbamimidoyl)benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(OCCN(C)C)c1)N(C)C |
| InChI | InChI=1S/C26H28Cl2N6O3/c1-33(2)11-12-37-22-13-16(24(29)34(3)4)5-8-19(22)25(35)31-21-9-6-17(27)14-20(21)26(36)32-23-10-7-18(28)15-30-23/h5-10,13-15,29H,11-12H2,1-4H3,(H,31,35)(H,30,32,36)/b29-24- |
| InChIKey | HGMLITCVWHXBFF-OLFWJLLRSA-N |
| XLogP | 4.72 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|