C24H22N4O — CID 44565635
(4-(1H-benzo[d]imidazol-2-yl)piperidin-1-yl)(4-(pyridin-2-yl)phenyl)methanone (PubChem CID 44565635) has the molecular formula C24H22N4O and a molecular weight of 382.50 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(4-pyridin-2-ylphenyl)methanone.
| Compound Name | (4-(1H-benzo[d]imidazol-2-yl)piperidin-1-yl)(4-(pyridin-2-yl)phenyl)methanone |
|---|---|
| PubChem CID | 44565635 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(4-pyridin-2-ylphenyl)methanone |
| SMILES | C1CN(CCC1C2=NC3=CC=CC=C3N2)C(=O)C4=CC=C(C=C4)C5=CC=CC=N5 |
| InChI | InChI=1S/C24H22N4O/c29-24(19-10-8-17(9-11-19)20-5-3-4-14-25-20)28-15-12-18(13-16-28)23-26-21-6-1-2-7-22(21)27-23/h1-11,14,18H,12-13,15-16H2,(H,26,27) |
| InChIKey | JVMOBZQNGJAHPD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | 553 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |