C41H54N2O — CID 44565674
1-[[(3S,4S)-1-[(1R)-2-benzyl-1-cyclohexylprop-2-enyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidin-4-ol (PubChem CID 44565674) has the molecular formula C41H54N2O and a molecular weight of 590.90 g/mol. Its IUPAC name is 1-[[(3S,4S)-1-[(1R)-2-benzyl-1-cyclohexylprop-2-enyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidin-4-ol.
| Compound Name | 1-[[(3S,4S)-1-[(1R)-2-benzyl-1-cyclohexylprop-2-enyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidin-4-ol |
|---|---|
| PubChem CID | 44565674 |
| Molecular Formula | C41H54N2O |
| Molecular Weight | 590.90 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | 1-[[(3S,4S)-1-[(1R)-2-benzyl-1-cyclohexylprop-2-enyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidin-4-ol |
| SMILES | C=C(Cc1ccccc1)[C@@H](C1CCCCC1)N1C[C@H](CN2CCC(O)(CCCc3ccccc3)CC2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C41H54N2O/c1-33(29-35-17-8-3-9-18-35)40(37-22-12-5-13-23-37)43-31-38(39(32-43)36-20-10-4-11-21-36)30-42-27-25-41(44,26-28-42)24-14-19-34-15-6-2-7-16-34/h2-4,6-11,15-18,20-21,37-40,44H,1,5,12-14,19,22-32H2/t38-,39+,40-/m0/s1 |
| InChIKey | NZJRJRHYDNPSFZ-UHULTCERSA-N |
| XLogP | 8.30 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.90 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|