C28H23ClF3N5O3 — CID 44565731
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide (PubChem CID 44565731) has the molecular formula C28H23ClF3N5O3 and a molecular weight of 569.97 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 44565731 |
| Molecular Formula | C28H23ClF3N5O3 |
| Molecular Weight | 569.97 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)ccn2)cc1 |
| InChI | InChI=1S/C28H23ClF3N5O3/c1-37(2)20-8-3-17(4-9-20)34-26(38)25-16-22(13-14-33-25)40-21-10-5-18(6-11-21)35-27(39)36-19-7-12-24(29)23(15-19)28(30,31)32/h3-16H,1-2H3,(H,34,38)(H2,35,36,39) |
| InChIKey | NNTFXEFBXICKQK-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.97 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|