C23H30N3O5P — CID 44565739
[(2R)-2-amino-2-[5-[4-(5-phenylpentoxy)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 44565739) has the molecular formula C23H30N3O5P and a molecular weight of 459.48 g/mol. Its IUPAC name is [(2R)-2-amino-2-[5-[4-(5-phenylpentoxy)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-2-[5-[4-(5-phenylpentoxy)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 44565739 |
| Molecular Formula | C23H30N3O5P |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [(2R)-2-amino-2-[5-[4-(5-phenylpentoxy)phenyl]-1H-imidazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)c1ncc(-c2ccc(OCCCCCc3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C23H30N3O5P/c1-23(24,17-31-32(27,28)29)22-25-16-21(26-22)19-11-13-20(14-12-19)30-15-7-3-6-10-18-8-4-2-5-9-18/h2,4-5,8-9,11-14,16H,3,6-7,10,15,17,24H2,1H3,(H,25,26)(H2,27,28,29)/t23-/m0/s1 |
| InChIKey | MJFHVHNIHASYLI-QHCPKHFHSA-N |
| XLogP | 4.15 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|