C28H34O4 — CID 44565755
(1R,3E,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 44565755) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (1R,3E,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | (1R,3E,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 44565755 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (1R,3E,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CC[C@H]1C[C@@]2(CC=C(C)C)C(=O)/C(=C(/O)c3ccccc3)C(=O)[C@H](C2=O)C1(C)C |
| InChI | InChI=1S/C28H34O4/c1-17(2)12-13-20-16-28(15-14-18(3)4)25(31)21(23(29)19-10-8-7-9-11-19)24(30)22(26(28)32)27(20,5)6/h7-12,14,20,22,29H,13,15-16H2,1-6H3/b23-21+/t20-,22+,28-/m0/s1 |
| InChIKey | FDFXENVYVICRCN-UDSGZEFSSA-N |
| XLogP | 6.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|