C21H25NO4 — CID 44565774
(1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-11,15-diol (PubChem CID 44565774) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-11,15-diol.
| Compound Name | (1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-11,15-diol |
|---|---|
| PubChem CID | 44565774 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-11,15-diol |
| SMILES | Oc1ccc2c3c1O[C@H]1[C@]4(O)CC[C@@]5(OC4)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C21H25NO4/c23-14-4-3-13-9-15-21-6-5-19(24,11-25-21)18-20(21,16(13)17(14)26-18)7-8-22(15)10-12-1-2-12/h3-4,12,15,18,23-24H,1-2,5-11H2/t15-,18+,19+,20+,21-/m1/s1 |
| InChIKey | NOOSMRUESWMKBO-OWYHGVQQSA-N |
| XLogP | 1.73 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |