C24H21ClF3N5O3 — CID 44565790
N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 44565790) has the molecular formula C24H21ClF3N5O3 and a molecular weight of 519.91 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 44565790 |
| Molecular Formula | C24H21ClF3N5O3 |
| Molecular Weight | 519.91 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(OCC(F)(F)F)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C24H21ClF3N5O3/c1-33(2)21(29)14-3-5-15(6-4-14)22(34)31-19-9-8-17(36-13-24(26,27)28)11-18(19)23(35)32-20-10-7-16(25)12-30-20/h3-12,29H,13H2,1-2H3,(H,31,34)(H,30,32,35)/b29-21- |
| InChIKey | RQPULMZJFUJILJ-ANYBSYGZSA-N |
| XLogP | 5.07 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.91 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|