About 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile
5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile (PubChem CID 44565796) has the molecular formula C14H22N6O
and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile |
| PubChem CID | 44565796 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile |
| SMILES | CC(C)(C)CNc1nc(C#N)nc(N2CCOCC2)c1N |
| InChI | InChI=1S/C14H22N6O/c1-14(2,3)9-17-12-11(16)13(19-10(8-15)18-12)20-4-6-21-7-5-20/h4-7,9,16H2,1-3H3,(H,17,18,19) |
| InChIKey | HLZVKJIKNRQXFG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile?
The IUPAC name of 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile (CID 44565796) is 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile.
What is the SMILES notation for 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile?
The canonical SMILES for 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile is CC(C)(C)CNc1nc(C#N)nc(N2CCOCC2)c1N.
What is the InChIKey of 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile?
The InChIKey is HLZVKJIKNRQXFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6O/c1-14(2,3)9-17-12-11(16)13(19-10(8-15)18-12)20-4-6-21-7-5-20/h4-7,9,16H2,1-3H3,(H,17,18,19).
What are the key properties of 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile?
5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile has a molecular weight of 290.37 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(2,2-dimethylpropylamino)-6-morpholin-4-ylpyrimidine-2-carbonitrile is sourced from PubChem (CID 44565796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).