C16H15NO — CID 44565816
6-phenylmethoxy-3,4-dihydroquinoline (PubChem CID 44565816) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 6-phenylmethoxy-3,4-dihydroquinoline.
| Compound Name | 6-phenylmethoxy-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 44565816 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 6-phenylmethoxy-3,4-dihydroquinoline |
| SMILES | C1=Nc2ccc(OCc3ccccc3)cc2CC1 |
| InChI | InChI=1S/C16H15NO/c1-2-5-13(6-3-1)12-18-15-8-9-16-14(11-15)7-4-10-17-16/h1-3,5-6,8-11H,4,7,12H2 |
| InChIKey | KNGXKSOFBFEUCZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |