About 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide
6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide (PubChem CID 44565885) has the molecular formula C19H25N5O
and a molecular weight of 339.44 g/mol. Its IUPAC name is 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide |
| PubChem CID | 44565885 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide |
| SMILES | Cc1cccc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)ccc2C(N)=O)c1 |
| InChI | InChI=1S/C19H25N5O/c1-12-5-4-6-13(11-12)22-19-14(18(21)25)9-10-17(24-19)23-16-8-3-2-7-15(16)20/h4-6,9-11,15-16H,2-3,7-8,20H2,1H3,(H2,21,25)(H2,22,23,24)/t15-,16+/m0/s1 |
| InChIKey | GLYDOFDMRWDEDQ-JKSUJKDBSA-N |
| XLogP | 2.91 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide?
The IUPAC name of 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide (CID 44565885) is 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide.
What is the SMILES notation for 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide?
The canonical SMILES for 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide is Cc1cccc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)ccc2C(N)=O)c1.
What is the InChIKey of 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide?
The InChIKey is GLYDOFDMRWDEDQ-JKSUJKDBSA-N. The full InChI is InChI=1S/C19H25N5O/c1-12-5-4-6-13(11-12)22-19-14(18(21)25)9-10-17(24-19)23-16-8-3-2-7-15(16)20/h4-6,9-11,15-16H,2-3,7-8,20H2,1H3,(H2,21,25)(H2,22,23,24)/t15-,16+/m0/s1.
What are the key properties of 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide?
6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide has a molecular weight of 339.44 g/mol, XLogP of 2.91, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(3-methylanilino)pyridine-3-carboxamide is sourced from PubChem (CID 44565885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).