C12H15NO4 — CID 44566014
(3S,4R,5R)-1-benzyl-3,4,5-trihydroxypiperidin-2-one (PubChem CID 44566014) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is (3S,4R,5R)-1-benzyl-3,4,5-trihydroxypiperidin-2-one.
| Compound Name | (3S,4R,5R)-1-benzyl-3,4,5-trihydroxypiperidin-2-one |
|---|---|
| PubChem CID | 44566014 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (3S,4R,5R)-1-benzyl-3,4,5-trihydroxypiperidin-2-one |
| SMILES | O=C1[C@@H](O)[C@H](O)[C@H](O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C12H15NO4/c14-9-7-13(12(17)11(16)10(9)15)6-8-4-2-1-3-5-8/h1-5,9-11,14-16H,6-7H2/t9-,10-,11+/m1/s1 |
| InChIKey | MECCYBVTZNHJMA-MXWKQRLJSA-N |
| XLogP | -0.89 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |