C17H18ClNO6 — CID 44566065
(2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-1',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one (PubChem CID 44566065) has the molecular formula C17H18ClNO6 and a molecular weight of 367.79 g/mol. Its IUPAC name is (2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-1',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one.
| Compound Name | (2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-1',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one |
|---|---|
| PubChem CID | 44566065 |
| Molecular Formula | C17H18ClNO6 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (2S,3'Z,5'R)-7-chloro-3'-hydroxyimino-1',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one |
| SMILES | COC1=C/C(=N\O)C[C@@H](C)[C@]12Oc1c(Cl)c(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C17H18ClNO6/c1-8-5-9(19-21)6-12(24-4)17(8)16(20)13-10(22-2)7-11(23-3)14(18)15(13)25-17/h6-8,21H,5H2,1-4H3/b19-9-/t8-,17+/m1/s1 |
| InChIKey | OVQUIBVMVDMJJI-MVDOQPSKSA-N |
| XLogP | 3.07 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|