C20H22O6 — CID 44566246
(4R,6R,8R,9Z,11E)-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione (PubChem CID 44566246) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (4R,6R,8R,9Z,11E)-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione.
| Compound Name | (4R,6R,8R,9Z,11E)-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione |
|---|---|
| PubChem CID | 44566246 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (4R,6R,8R,9Z,11E)-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione |
| SMILES | COc1cc2c(c(OC)c1)C(=O)O[C@H](C)C[C@H]1O[C@@H]1/C=C/C=C/C(=O)C2 |
| InChI | InChI=1S/C20H22O6/c1-12-8-17-16(26-17)7-5-4-6-14(21)9-13-10-15(23-2)11-18(24-3)19(13)20(22)25-12/h4-7,10-12,16-17H,8-9H2,1-3H3/b6-4+,7-5+/t12-,16-,17-/m1/s1 |
| InChIKey | YOOKPIGRXLTXFP-KHSJTDRXSA-N |
| XLogP | 2.64 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|