C21H32O8 — CID 44566369
butyl (3R)-5-phenyl-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoate (PubChem CID 44566369) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is butyl (3R)-5-phenyl-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoate.
| Compound Name | butyl (3R)-5-phenyl-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 44566369 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | butyl (3R)-5-phenyl-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoate |
| SMILES | CCCCOC(=O)C[C@@H](CCc1ccccc1)O[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H32O8/c1-2-3-11-27-17(23)12-15(10-9-14-7-5-4-6-8-14)28-21-20(26)19(25)18(24)16(13-22)29-21/h4-8,15-16,18-22,24-26H,2-3,9-13H2,1H3/t15-,16+,18+,19-,20+,21+/m1/s1 |
| InChIKey | JJNDFNDBAISVMO-UIVYVLBTSA-N |
| XLogP | 0.54 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|