C37H53NO3 — CID 44566378
(2R,4aS,6aR,6aS,6bR,8aR,10Z,12aR,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10-phenylmethoxyimino-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid (PubChem CID 44566378) has the molecular formula C37H53NO3 and a molecular weight of 559.84 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,6bR,8aR,10Z,12aR,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10-phenylmethoxyimino-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aR,6aS,6bR,8aR,10Z,12aR,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10-phenylmethoxyimino-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 44566378 |
| Molecular Formula | C37H53NO3 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.40 |
| IUPAC Name | (2R,4aS,6aR,6aS,6bR,8aR,10Z,12aR,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10-phenylmethoxyimino-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxylic acid |
| SMILES | CC1(C)/C(=N\OCc2ccccc2)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@](C)(C(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C37H53NO3/c1-32(2)28-15-18-37(7)29(35(28,5)17-16-30(32)38-41-24-25-11-9-8-10-12-25)14-13-26-27-23-34(4,31(39)40)20-19-33(27,3)21-22-36(26,37)6/h8-13,27-29H,14-24H2,1-7H3,(H,39,40)/b38-30-/t27-,28-,29+,33+,34+,35-,36+,37+/m0/s1 |
| InChIKey | XXJSDGVUWBDUDZ-KVEBJDLGSA-N |
| XLogP | 9.45 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|