C23H38O6 — CID 44566428
[(2S,3R,4R,5R,8R,11S,14R,15R)-15-hydroxy-14-methoxy-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate (PubChem CID 44566428) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(2S,3R,4R,5R,8R,11S,14R,15R)-15-hydroxy-14-methoxy-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5R,8R,11S,14R,15R)-15-hydroxy-14-methoxy-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
|---|---|
| PubChem CID | 44566428 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | [(2S,3R,4R,5R,8R,11S,14R,15R)-15-hydroxy-14-methoxy-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
| SMILES | CO[C@@H]1CC[C@]2(C)OC[C@H](C)C3C[C@@H](C)[C@@H](OC(C)=O)[C@H]4C(C[C@@]1(C)O)OC2[C@@H]34 |
| InChI | InChI=1S/C23H38O6/c1-12-9-15-13(2)11-27-23(5)8-7-17(26-6)22(4,25)10-16-19(18(15)21(23)29-16)20(12)28-14(3)24/h12-13,15-21,25H,7-11H2,1-6H3/t12-,13+,15?,16?,17-,18+,19+,20-,21?,22-,23+/m1/s1 |
| InChIKey | SHHCCZSDXWGINH-VWIFSDQYSA-N |
| XLogP | 2.95 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |