C21H32O5 — CID 44566430
[(2S,3R,4R,5R,8R,11S)-5,8,11-trimethyl-15-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate (PubChem CID 44566430) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is [(2S,3R,4R,5R,8R,11S)-5,8,11-trimethyl-15-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5R,8R,11S)-5,8,11-trimethyl-15-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
|---|---|
| PubChem CID | 44566430 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [(2S,3R,4R,5R,8R,11S)-5,8,11-trimethyl-15-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2C3CC(=O)CCC[C@]4(C)OC[C@H](C)C(C[C@H]1C)[C@@H]2C4O3 |
| InChI | InChI=1S/C21H32O5/c1-11-8-15-12(2)10-24-21(4)7-5-6-14(23)9-16-18(17(15)20(21)26-16)19(11)25-13(3)22/h11-12,15-20H,5-10H2,1-4H3/t11-,12+,15?,16?,17+,18+,19-,20?,21+/m1/s1 |
| InChIKey | ARTZUUBHXRPSMO-HFIGZDJHSA-N |
| XLogP | 3.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |