C22H32O4 — CID 44566672
[(1R,2E,6R,8R,11E)-3,8,12-trimethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-16-yl]methyl acetate (PubChem CID 44566672) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1R,2E,6R,8R,11E)-3,8,12-trimethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-16-yl]methyl acetate.
| Compound Name | [(1R,2E,6R,8R,11E)-3,8,12-trimethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-16-yl]methyl acetate |
|---|---|
| PubChem CID | 44566672 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1R,2E,6R,8R,11E)-3,8,12-trimethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-16-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C2CC/C(C)=C/CC[C@@]3(C)O[C@@H]3CC/C(C)=C/[C@H]2OC1 |
| InChI | InChI=1S/C22H32O4/c1-15-6-5-11-22(4)21(26-22)10-8-16(2)12-20-19(9-7-15)18(14-25-20)13-24-17(3)23/h6,12,20-21H,5,7-11,13-14H2,1-4H3/b15-6+,16-12+/t20-,21-,22-/m1/s1 |
| InChIKey | TXHSJFIFLNLZSW-RPQIXLEKSA-N |
| XLogP | 4.65 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|