C29H34O6 — CID 44566695
3-[(2S,3R)-7-hydroxy-2,3-dimethyl-6-(3-methylbut-3-enyl)-6-(2-methylprop-1-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid (PubChem CID 44566695) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-[(2S,3R)-7-hydroxy-2,3-dimethyl-6-(3-methylbut-3-enyl)-6-(2-methylprop-1-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[(2S,3R)-7-hydroxy-2,3-dimethyl-6-(3-methylbut-3-enyl)-6-(2-methylprop-1-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 44566695 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 3-[(2S,3R)-7-hydroxy-2,3-dimethyl-6-(3-methylbut-3-enyl)-6-(2-methylprop-1-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid |
| SMILES | C=C(C)CCC1(C=C(C)C)C(=O)C2=C(O[C@@H](C)[C@@H](C)C2=O)C(C(CC(=O)O)c2ccccc2)=C1O |
| InChI | InChI=1S/C29H34O6/c1-16(2)12-13-29(15-17(3)4)27(33)23(21(14-22(30)31)20-10-8-7-9-11-20)26-24(28(29)34)25(32)18(5)19(6)35-26/h7-11,15,18-19,21,33H,1,12-14H2,2-6H3,(H,30,31)/t18-,19+,21?,29?/m1/s1 |
| InChIKey | GZNWWAGBASVLIH-KDEHGAQWSA-N |
| XLogP | 5.83 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|