C15H24O3 — CID 44566709
(1R,3S,5S,8S,10S,13R)-1,6,6,10-tetramethyl-4,9,14-trioxatetracyclo[11.1.0.03,5.08,10]tetradecane (PubChem CID 44566709) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,3S,5S,8S,10S,13R)-1,6,6,10-tetramethyl-4,9,14-trioxatetracyclo[11.1.0.03,5.08,10]tetradecane.
| Compound Name | (1R,3S,5S,8S,10S,13R)-1,6,6,10-tetramethyl-4,9,14-trioxatetracyclo[11.1.0.03,5.08,10]tetradecane |
|---|---|
| PubChem CID | 44566709 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,3S,5S,8S,10S,13R)-1,6,6,10-tetramethyl-4,9,14-trioxatetracyclo[11.1.0.03,5.08,10]tetradecane |
| SMILES | CC1(C)C[C@@H]2O[C@@]2(C)CC[C@H]2O[C@]2(C)C[C@@H]2O[C@H]21 |
| InChI | InChI=1S/C15H24O3/c1-13(2)8-11-14(3,18-11)6-5-10-15(4,17-10)7-9-12(13)16-9/h9-12H,5-8H2,1-4H3/t9-,10+,11-,12+,14-,15+/m0/s1 |
| InChIKey | DKHWLZDWNCVYPO-SYPGZIFDSA-N |
| XLogP | 2.67 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|