C36H36O10 — CID 44566810
[7,15-diacetyloxy-19,19-dimethyl-22-(3-methylbut-2-enyl)-11-(2-methylprop-1-enyl)-13-oxo-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-6-yl] acetate (PubChem CID 44566810) has the molecular formula C36H36O10 and a molecular weight of 628.67 g/mol. Its IUPAC name is [7,15-diacetyloxy-19,19-dimethyl-22-(3-methylbut-2-enyl)-11-(2-methylprop-1-enyl)-13-oxo-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-6-yl] acetate.
| Compound Name | [7,15-diacetyloxy-19,19-dimethyl-22-(3-methylbut-2-enyl)-11-(2-methylprop-1-enyl)-13-oxo-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-6-yl] acetate |
|---|---|
| PubChem CID | 44566810 |
| Molecular Formula | C36H36O10 |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | [7,15-diacetyloxy-19,19-dimethyl-22-(3-methylbut-2-enyl)-11-(2-methylprop-1-enyl)-13-oxo-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-6-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1OC(C)=O)-c1oc3c(CC=C(C)C)c4c(c(OC(C)=O)c3c(=O)c1C(C=C(C)C)O2)C=CC(C)(C)O4 |
| InChI | InChI=1S/C36H36O10/c1-17(2)10-11-22-32-23(12-13-36(8,9)46-32)33(43-21(7)39)30-31(40)29-28(14-18(3)4)44-25-16-27(42-20(6)38)26(41-19(5)37)15-24(25)35(29)45-34(22)30/h10,12-16,28H,11H2,1-9H3 |
| InChIKey | XPLGPCNCLXWQHN-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|