C21H31N — CID 44566843
(1S,3aR,4S,6S,6aS,9aS,9bR)-1,4-dimethyl-7-methylidene-6-(2-methylprop-2-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalene-1-carbonitrile (PubChem CID 44566843) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (1S,3aR,4S,6S,6aS,9aS,9bR)-1,4-dimethyl-7-methylidene-6-(2-methylprop-2-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalene-1-carbonitrile.
| Compound Name | (1S,3aR,4S,6S,6aS,9aS,9bR)-1,4-dimethyl-7-methylidene-6-(2-methylprop-2-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalene-1-carbonitrile |
|---|---|
| PubChem CID | 44566843 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (1S,3aR,4S,6S,6aS,9aS,9bR)-1,4-dimethyl-7-methylidene-6-(2-methylprop-2-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalene-1-carbonitrile |
| SMILES | C=C(C)C[C@@H]1C[C@H](C)[C@H]2CC[C@](C)(C#N)[C@H]3CCC(=C)[C@@H]1[C@H]23 |
| InChI | InChI=1S/C21H31N/c1-13(2)10-16-11-15(4)17-8-9-21(5,12-22)18-7-6-14(3)19(16)20(17)18/h15-20H,1,3,6-11H2,2,4-5H3/t15-,16+,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | OSTUOHSDKCQCCA-QJZPXWABSA-N |
| XLogP | 5.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|