C21H31N — CID 44566852
(2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylene-5-carbonitrile (PubChem CID 44566852) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylene-5-carbonitrile.
| Compound Name | (2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylene-5-carbonitrile |
|---|---|
| PubChem CID | 44566852 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylene-5-carbonitrile |
| SMILES | C=C(C)/C=C/[C@]12C[C@H](C)[C@H]3CC[C@](C)(C#N)[C@@H](CC[C@H]1C)[C@@H]32 |
| InChI | InChI=1S/C21H31N/c1-14(2)8-11-21-12-15(3)17-9-10-20(5,13-22)18(19(17)21)7-6-16(21)4/h8,11,15-19H,1,6-7,9-10,12H2,2-5H3/b11-8+/t15-,16+,17+,18-,19+,20+,21-/m0/s1 |
| InChIKey | SSFDJDHBZVHNKM-SSBPHEBUSA-N |
| XLogP | 5.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|