C30H44O4 — CID 44566889
(1R,2R,5R,10R,11R,14R,15S,16S,17R,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-7,18-dione (PubChem CID 44566889) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (1R,2R,5R,10R,11R,14R,15S,16S,17R,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-7,18-dione.
| Compound Name | (1R,2R,5R,10R,11R,14R,15S,16S,17R,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-7,18-dione |
|---|---|
| PubChem CID | 44566889 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (1R,2R,5R,10R,11R,14R,15S,16S,17R,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-7,18-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@H]3CC[C@@H]4[C@H]5[C@H]6[C@@H](C[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12)OC(=O)[C@]61CO1 |
| InChI | InChI=1S/C30H44O4/c1-25(2)19-9-12-29(6)20(27(19,4)11-10-21(25)31)8-7-17-22-23-18(34-24(32)30(23)16-33-30)15-26(22,3)13-14-28(17,29)5/h17-20,22-23H,7-16H2,1-6H3/t17-,18-,19+,20-,22+,23-,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | BSKDFVKLMLKTPZ-CIKWVUGESA-N |
| XLogP | 5.96 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|