C23H34O3 — CID 44566894
(1R,5R,6R)-4-ethyl-5-hydroxy-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 44566894) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (1R,5R,6R)-4-ethyl-5-hydroxy-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5R,6R)-4-ethyl-5-hydroxy-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 44566894 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (1R,5R,6R)-4-ethyl-5-hydroxy-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CCC1=CC(=O)[C@]2(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C23H34O3/c1-6-19-15-20(24)23(22(26-23)21(19)25)14-13-18(5)12-8-11-17(4)10-7-9-16(2)3/h9,11,13,15,21-22,25H,6-8,10,12,14H2,1-5H3/b17-11+,18-13+/t21-,22-,23+/m1/s1 |
| InChIKey | BMDMRPRGJZSKOI-BVNLDUDUSA-N |
| XLogP | 5.21 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|