About (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione
(3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 44566899) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione |
| PubChem CID | 44566899 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C11H20N2O2/c1-6(2)5-8-10(14)13-9(7(3)4)11(15)12-8/h6-9H,5H2,1-4H3,(H,12,15)(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | UPOUGDHEEGKEGS-RKDXNWHRSA-N |
| XLogP | 0.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione?
The IUPAC name of (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione (CID 44566899) is (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione.
What is the SMILES notation for (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione?
The canonical SMILES for (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione is CC(C)C[C@H]1NC(=O)[C@@H](C(C)C)NC1=O.
What is the InChIKey of (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione?
The InChIKey is UPOUGDHEEGKEGS-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-6(2)5-8-10(14)13-9(7(3)4)11(15)12-8/h6-9H,5H2,1-4H3,(H,12,15)(H,13,14)/t8-,9-/m1/s1.
What are the key properties of (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione?
(3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione has a molecular weight of 212.29 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6R)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione is sourced from PubChem (CID 44566899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).