C15H18O4 — CID 44566953
(1R,2R,3R,7S,11R,12S)-11-hydroxy-1,10-dimethyl-6-methylidene-4,13-dioxatetracyclo[10.1.1.02,11.03,7]tetradec-9-en-5-one (PubChem CID 44566953) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (1R,2R,3R,7S,11R,12S)-11-hydroxy-1,10-dimethyl-6-methylidene-4,13-dioxatetracyclo[10.1.1.02,11.03,7]tetradec-9-en-5-one.
| Compound Name | (1R,2R,3R,7S,11R,12S)-11-hydroxy-1,10-dimethyl-6-methylidene-4,13-dioxatetracyclo[10.1.1.02,11.03,7]tetradec-9-en-5-one |
|---|---|
| PubChem CID | 44566953 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1R,2R,3R,7S,11R,12S)-11-hydroxy-1,10-dimethyl-6-methylidene-4,13-dioxatetracyclo[10.1.1.02,11.03,7]tetradec-9-en-5-one |
| SMILES | C=C1C(=O)O[C@H]2[C@@H]3[C@@](O)(C(C)=CC[C@@H]12)[C@@H]1C[C@@]3(C)O1 |
| InChI | InChI=1S/C15H18O4/c1-7-4-5-9-8(2)13(16)18-11(9)12-14(3)6-10(19-14)15(7,12)17/h4,9-12,17H,2,5-6H2,1,3H3/t9-,10-,11+,12-,14+,15+/m0/s1 |
| InChIKey | LDGHSQJVMCMJNB-MDFWMIKMSA-N |
| XLogP | 1.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|