C28H36O6 — CID 44567001
(2aR,3R,4R,5S,5aR,6aS,6bR,12aS,12bS,12cS)-2a,4,5a-trihydroxy-3,3',4',6b,12c-pentamethylspiro[1,2,3,4,6,6a,10,12,12a,12b-decahydrobenzo[j]aceanthrylene-5,5'-furan]-2',7-dione (PubChem CID 44567001) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is (2aR,3R,4R,5S,5aR,6aS,6bR,12aS,12bS,12cS)-2a,4,5a-trihydroxy-3,3',4',6b,12c-pentamethylspiro[1,2,3,4,6,6a,10,12,12a,12b-decahydrobenzo[j]aceanthrylene-5,5'-furan]-2',7-dione.
| Compound Name | (2aR,3R,4R,5S,5aR,6aS,6bR,12aS,12bS,12cS)-2a,4,5a-trihydroxy-3,3',4',6b,12c-pentamethylspiro[1,2,3,4,6,6a,10,12,12a,12b-decahydrobenzo[j]aceanthrylene-5,5'-furan]-2',7-dione |
|---|---|
| PubChem CID | 44567001 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (2aR,3R,4R,5S,5aR,6aS,6bR,12aS,12bS,12cS)-2a,4,5a-trihydroxy-3,3',4',6b,12c-pentamethylspiro[1,2,3,4,6,6a,10,12,12a,12b-decahydrobenzo[j]aceanthrylene-5,5'-furan]-2',7-dione |
| SMILES | CC1=C(C)[C@]2(OC1=O)[C@H](O)[C@@H](C)[C@]1(O)CC[C@H]3[C@@H]4CC=C5CC=CC(=O)[C@]5(C)[C@H]4C[C@@]2(O)[C@@]31C |
| InChI | InChI=1S/C28H36O6/c1-14-15(2)28(34-23(14)31)22(30)16(3)26(32)12-11-19-18-10-9-17-7-6-8-21(29)24(17,4)20(18)13-27(28,33)25(19,26)5/h6,8-9,16,18-20,22,30,32-33H,7,10-13H2,1-5H3/t16-,18+,19+,20+,22-,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | PUGVQJIZFAUFIH-KVZDTKSGSA-N |
| XLogP | 3.01 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|