C24H34O5 — CID 44567071
[(1S,5R,6S,8R)-8-[1-[(1R,3aS,8aS)-4,4,8a-trimethyl-8-methylidene-2,3,3a,5,6,7-hexahydro-1H-azulen-1-yl]ethenyl]-3-oxo-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate (PubChem CID 44567071) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(1S,5R,6S,8R)-8-[1-[(1R,3aS,8aS)-4,4,8a-trimethyl-8-methylidene-2,3,3a,5,6,7-hexahydro-1H-azulen-1-yl]ethenyl]-3-oxo-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate.
| Compound Name | [(1S,5R,6S,8R)-8-[1-[(1R,3aS,8aS)-4,4,8a-trimethyl-8-methylidene-2,3,3a,5,6,7-hexahydro-1H-azulen-1-yl]ethenyl]-3-oxo-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate |
|---|---|
| PubChem CID | 44567071 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(1S,5R,6S,8R)-8-[1-[(1R,3aS,8aS)-4,4,8a-trimethyl-8-methylidene-2,3,3a,5,6,7-hexahydro-1H-azulen-1-yl]ethenyl]-3-oxo-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate |
| SMILES | C=C([C@@H]1[C@@H]2OC(=O)C[C@H]1[C@H](OC(C)=O)O2)[C@H]1CC[C@H]2C(C)(C)CCCC(=C)[C@]12C |
| InChI | InChI=1S/C24H34O5/c1-13-8-7-11-23(4,5)18-10-9-17(24(13,18)6)14(2)20-16-12-19(26)28-22(20)29-21(16)27-15(3)25/h16-18,20-22H,1-2,7-12H2,3-6H3/t16-,17-,18+,20+,21-,22-,24-/m1/s1 |
| InChIKey | FFIKMGRZTXHWIJ-FUGOPSOPSA-N |
| XLogP | 4.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|