C14H22O4 — CID 44567099
[(3aR,7aR)-6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl] hexanoate (PubChem CID 44567099) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is [(3aR,7aR)-6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl] hexanoate.
| Compound Name | [(3aR,7aR)-6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl] hexanoate |
|---|---|
| PubChem CID | 44567099 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [(3aR,7aR)-6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@]12C=CC(O)C[C@H]1OCC2 |
| InChI | InChI=1S/C14H22O4/c1-2-3-4-5-13(16)18-14-7-6-11(15)10-12(14)17-9-8-14/h6-7,11-12,15H,2-5,8-10H2,1H3/t11?,12-,14+/m1/s1 |
| InChIKey | VIUKZACCVISNML-AOUZGSJDSA-N |
| XLogP | 1.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|