C22H26O7 — CID 44567134
[(3R,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 44567134) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [(3R,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3R,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 44567134 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(3R,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CC(CO)=C2C(=O)C=C(C)[C@H]2[C@@H]2OC(=O)[C@@](C)(C(C)=O)[C@@H]21 |
| InChI | InChI=1S/C22H26O7/c1-6-10(2)20(26)28-15-8-13(9-23)17-14(25)7-11(3)16(17)19-18(15)22(5,12(4)24)21(27)29-19/h6-7,15-16,18-19,23H,8-9H2,1-5H3/b10-6-/t15-,16+,18+,19-,22-/m0/s1 |
| InChIKey | XRDAGANPEKIGCB-VITIEYFVSA-N |
| XLogP | 1.84 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|