C21H24O7 — CID 44567136
[(3S,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate (PubChem CID 44567136) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is [(3S,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(3S,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 44567136 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(3S,3aR,4S,9aR,9bS)-3-acetyl-6-(hydroxymethyl)-3,9-dimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1CC(CO)=C2C(=O)C=C(C)[C@H]2[C@@H]2OC(=O)[C@](C)(C(C)=O)[C@@H]21 |
| InChI | InChI=1S/C21H24O7/c1-9(2)19(25)27-14-7-12(8-22)16-13(24)6-10(3)15(16)18-17(14)21(5,11(4)23)20(26)28-18/h6,14-15,17-18,22H,1,7-8H2,2-5H3/t14-,15+,17+,18-,21+/m0/s1 |
| InChIKey | RXWUUMXKLCYTCS-BSEUJLJWSA-N |
| XLogP | 1.45 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|