About 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide
2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide (PubChem CID 44567230) has the molecular formula C17H16ClIN2O
and a molecular weight of 426.69 g/mol. Its IUPAC name is 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide.
Molecular Properties
| Compound Name | 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide |
| PubChem CID | 44567230 |
| Molecular Formula | C17H16ClIN2O |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide |
| SMILES | Cn1cc[n+](C)c1/C=C/c1ccc(-c2ccccc2Cl)o1.[I-] |
| InChI | InChI=1S/C17H16ClN2O.HI/c1-19-11-12-20(2)17(19)10-8-13-7-9-16(21-13)14-5-3-4-6-15(14)18;/h3-12H,1-2H3;1H/q+1;/p-1/b10-8+; |
| InChIKey | CHDJZMWICNNCTI-VRTOBVRTSA-M |
| XLogP | 0.94 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide?
The IUPAC name of 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide (CID 44567230) is 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide.
What is the SMILES notation for 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide?
The canonical SMILES for 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide is Cn1cc[n+](C)c1/C=C/c1ccc(-c2ccccc2Cl)o1.[I-].
What is the InChIKey of 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide?
The InChIKey is CHDJZMWICNNCTI-VRTOBVRTSA-M. The full InChI is InChI=1S/C17H16ClN2O.HI/c1-19-11-12-20(2)17(19)10-8-13-7-9-16(21-13)14-5-3-4-6-15(14)18;/h3-12H,1-2H3;1H/q+1;/p-1/b10-8+;.
What are the key properties of 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide?
2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide has a molecular weight of 426.69 g/mol, XLogP of 0.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[5-(2-chlorophenyl)furan-2-yl]ethenyl]-1,3-dimethylimidazol-1-ium iodide is sourced from PubChem (CID 44567230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).