C18H19NO2 — CID 44567292
(6aR)-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol (PubChem CID 44567292) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (6aR)-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol.
| Compound Name | (6aR)-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol |
|---|---|
| PubChem CID | 44567292 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (6aR)-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol |
| SMILES | Cc1cc2c3c(c1)-c1c(ccc(O)c1O)C[C@H]3N(C)CC2 |
| InChI | InChI=1S/C18H19NO2/c1-10-7-12-5-6-19(2)14-9-11-3-4-15(20)18(21)17(11)13(8-10)16(12)14/h3-4,7-8,14,20-21H,5-6,9H2,1-2H3/t14-/m1/s1 |
| InChIKey | QRJZCXSRTBCYIW-CQSZACIVSA-N |
| XLogP | 3.16 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|