About ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate
ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate (PubChem CID 44567337) has the molecular formula C16H18Cl2O4S
and a molecular weight of 377.29 g/mol. Its IUPAC name is ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
| PubChem CID | 44567337 |
| Molecular Formula | C16H18Cl2O4S |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2O4S/c1-2-22-16(19)12-5-3-4-6-15(12)23(20,21)10-11-7-8-13(17)14(18)9-11/h5,7-9,15H,2-4,6,10H2,1H3 |
| InChIKey | YENLDKBFBOHYPS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate?
The IUPAC name of ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate (CID 44567337) is ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate.
What is the SMILES notation for ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate?
The canonical SMILES for ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate is CCOC(=O)C1=CCCCC1S(=O)(=O)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate?
The InChIKey is YENLDKBFBOHYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2O4S/c1-2-22-16(19)12-5-3-4-6-15(12)23(20,21)10-11-7-8-13(17)14(18)9-11/h5,7-9,15H,2-4,6,10H2,1H3.
What are the key properties of ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate?
ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate has a molecular weight of 377.29 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(3,4-dichlorophenyl)methylsulfonyl]cyclohexene-1-carboxylate is sourced from PubChem (CID 44567337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).