About 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide
2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide (PubChem CID 44567402) has the molecular formula C18H14Cl2INO
and a molecular weight of 458.13 g/mol. Its IUPAC name is 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide.
Molecular Properties
| Compound Name | 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide |
| PubChem CID | 44567402 |
| Molecular Formula | C18H14Cl2INO |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide |
| SMILES | C[n+]1ccccc1/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1.[I-] |
| InChI | InChI=1S/C18H14Cl2NO.HI/c1-21-11-3-2-4-14(21)6-7-15-8-10-18(22-15)16-9-5-13(19)12-17(16)20;/h2-12H,1H3;1H/q+1;/p-1/b7-6+; |
| InChIKey | SVRBHZSAVLXWRY-UHDJGPCESA-M |
| XLogP | 2.25 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide?
The IUPAC name of 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide (CID 44567402) is 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide.
What is the SMILES notation for 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide?
The canonical SMILES for 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide is C[n+]1ccccc1/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1.[I-].
What is the InChIKey of 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide?
The InChIKey is SVRBHZSAVLXWRY-UHDJGPCESA-M. The full InChI is InChI=1S/C18H14Cl2NO.HI/c1-21-11-3-2-4-14(21)6-7-15-8-10-18(22-15)16-9-5-13(19)12-17(16)20;/h2-12H,1H3;1H/q+1;/p-1/b7-6+;.
What are the key properties of 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide?
2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide has a molecular weight of 458.13 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[5-(2,4-dichlorophenyl)furan-2-yl]ethenyl]-1-methylpyridin-1-ium iodide is sourced from PubChem (CID 44567402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).