About ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate
ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate (PubChem CID 44567538) has the molecular formula C19H14N2O4
and a molecular weight of 334.33 g/mol. Its IUPAC name is ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate.
Molecular Properties
| Compound Name | ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate |
| PubChem CID | 44567538 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate |
| SMILES | CCOC(=O)c1c2c(n3cccc(C)c13)C(=O)c1cccnc1C2=O |
| InChI | InChI=1S/C19H14N2O4/c1-3-25-19(24)13-12-16(21-9-5-6-10(2)15(13)21)17(22)11-7-4-8-20-14(11)18(12)23/h4-9H,3H2,1-2H3 |
| InChIKey | RPESDIWLFSAZET-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate?
The IUPAC name of ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate (CID 44567538) is ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate.
What is the SMILES notation for ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate?
The canonical SMILES for ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate is CCOC(=O)c1c2c(n3cccc(C)c13)C(=O)c1cccnc1C2=O.
What is the InChIKey of ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate?
The InChIKey is RPESDIWLFSAZET-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O4/c1-3-25-19(24)13-12-16(21-9-5-6-10(2)15(13)21)17(22)11-7-4-8-20-14(11)18(12)23/h4-9H,3H2,1-2H3.
What are the key properties of ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate?
ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate has a molecular weight of 334.33 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 10-methyl-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate is sourced from PubChem (CID 44567538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).