C25H32N4O3 — CID 44567753
(2R)-2-[(2R,5S)-5-[(2R)-2-[4-(3-phenoxyprop-1-ynyl)triazol-1-yl]propyl]oxolan-2-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 44567753) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (2R)-2-[(2R,5S)-5-[(2R)-2-[4-(3-phenoxyprop-1-ynyl)triazol-1-yl]propyl]oxolan-2-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2R)-2-[(2R,5S)-5-[(2R)-2-[4-(3-phenoxyprop-1-ynyl)triazol-1-yl]propyl]oxolan-2-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 44567753 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (2R)-2-[(2R,5S)-5-[(2R)-2-[4-(3-phenoxyprop-1-ynyl)triazol-1-yl]propyl]oxolan-2-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C[C@H](C[C@@H]1CC[C@H]([C@@H](C)C(=O)N2CCCC2)O1)n1cc(C#CCOc2ccccc2)nn1 |
| InChI | InChI=1S/C25H32N4O3/c1-19(17-23-12-13-24(32-23)20(2)25(30)28-14-6-7-15-28)29-18-21(26-27-29)9-8-16-31-22-10-4-3-5-11-22/h3-5,10-11,18-20,23-24H,6-7,12-17H2,1-2H3/t19-,20-,23+,24-/m1/s1 |
| InChIKey | UYEMKQXXLJAUAZ-MYSJAJEPSA-N |
| XLogP | 3.47 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|