About 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol
2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol (PubChem CID 44567878) has the molecular formula C15H13Cl2N3O
and a molecular weight of 322.20 g/mol. Its IUPAC name is 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol |
| PubChem CID | 44567878 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol |
| SMILES | Nc1nn(CCO)c2cc(-c3ccc(Cl)cc3Cl)ccc12 |
| InChI | InChI=1S/C15H13Cl2N3O/c16-10-2-4-11(13(17)8-10)9-1-3-12-14(7-9)20(5-6-21)19-15(12)18/h1-4,7-8,21H,5-6H2,(H2,18,19) |
| InChIKey | RLTOUMQUJUZPPL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol?
The IUPAC name of 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol (CID 44567878) is 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol.
What is the SMILES notation for 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol?
The canonical SMILES for 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol is Nc1nn(CCO)c2cc(-c3ccc(Cl)cc3Cl)ccc12.
What is the InChIKey of 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol?
The InChIKey is RLTOUMQUJUZPPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3O/c16-10-2-4-11(13(17)8-10)9-1-3-12-14(7-9)20(5-6-21)19-15(12)18/h1-4,7-8,21H,5-6H2,(H2,18,19).
What are the key properties of 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol?
2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol has a molecular weight of 322.20 g/mol, XLogP of 3.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-amino-6-(2,4-dichlorophenyl)indazol-1-yl]ethanol is sourced from PubChem (CID 44567878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).