C25H30ClN7O — CID 44568011
N-(4-chlorophenyl)-4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide (PubChem CID 44568011) has the molecular formula C25H30ClN7O and a molecular weight of 480.02 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 44568011 |
| Molecular Formula | C25H30ClN7O |
| Molecular Weight | 480.02 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)C1CN(C(=O)Nc2ccc(Cl)cc2)CCN1/C(=N/c1cccc2c1CCNC2)NC#N |
| InChI | InChI=1S/C25H30ClN7O/c1-17(2)23-15-32(25(34)30-20-8-6-19(26)7-9-20)12-13-33(23)24(29-16-27)31-22-5-3-4-18-14-28-11-10-21(18)22/h3-9,17,23,28H,10-15H2,1-2H3,(H,29,31)(H,30,34) |
| InChIKey | MKYCRVIUKFCFNX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.02 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|