About 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione
2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione (PubChem CID 44568082) has the molecular formula C21H22ClNO2
and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione |
| PubChem CID | 44568082 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione |
| SMILES | CCCC1(CCC)C(=O)N(c2ccc(Cl)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H22ClNO2/c1-3-13-21(14-4-2)18-8-6-5-7-17(18)19(24)23(20(21)25)16-11-9-15(22)10-12-16/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | CISKBKRHBBMINT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione?
The IUPAC name of 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione (CID 44568082) is 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione.
What is the SMILES notation for 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione?
The canonical SMILES for 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione is CCCC1(CCC)C(=O)N(c2ccc(Cl)cc2)C(=O)c2ccccc21.
What is the InChIKey of 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione?
The InChIKey is CISKBKRHBBMINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO2/c1-3-13-21(14-4-2)18-8-6-5-7-17(18)19(24)23(20(21)25)16-11-9-15(22)10-12-16/h5-12H,3-4,13-14H2,1-2H3.
What are the key properties of 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione?
2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione has a molecular weight of 355.87 g/mol, XLogP of 5.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4,4-dipropylisoquinoline-1,3-dione is sourced from PubChem (CID 44568082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).