About 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione
2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione (PubChem CID 44568084) has the molecular formula C19H16ClNO2
and a molecular weight of 325.80 g/mol. Its IUPAC name is 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione.
Molecular Properties
| Compound Name | 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione |
| PubChem CID | 44568084 |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione |
| SMILES | O=C1c2ccccc2C2(CCCC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClNO2/c20-13-7-9-14(10-8-13)21-17(22)15-5-1-2-6-16(15)19(18(21)23)11-3-4-12-19/h1-2,5-10H,3-4,11-12H2 |
| InChIKey | SULQASZPSYYHOD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione?
The IUPAC name of 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione (CID 44568084) is 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione.
What is the SMILES notation for 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione?
The canonical SMILES for 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione is O=C1c2ccccc2C2(CCCC2)C(=O)N1c1ccc(Cl)cc1.
What is the InChIKey of 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione?
The InChIKey is SULQASZPSYYHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClNO2/c20-13-7-9-14(10-8-13)21-17(22)15-5-1-2-6-16(15)19(18(21)23)11-3-4-12-19/h1-2,5-10H,3-4,11-12H2.
What are the key properties of 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione?
2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione has a molecular weight of 325.80 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-(4-chlorophenyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione is sourced from PubChem (CID 44568084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).