C30H36N4O3 — CID 44568116
(2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-phenoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide (PubChem CID 44568116) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is (2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-phenoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide.
| Compound Name | (2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-phenoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 44568116 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | (2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-phenoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide |
| SMILES | CCN(CC)C(=O)[C@H](C)[C@H]1CC[C@@H](C[C@@H](C)n2cc(C#Cc3ccc(Oc4ccccc4)cc3)nn2)O1 |
| InChI | InChI=1S/C30H36N4O3/c1-5-33(6-2)30(35)23(4)29-19-18-28(37-29)20-22(3)34-21-25(31-32-34)15-12-24-13-16-27(17-14-24)36-26-10-8-7-9-11-26/h7-11,13-14,16-17,21-23,28-29H,5-6,18-20H2,1-4H3/t22-,23-,28+,29-/m1/s1 |
| InChIKey | KSEFAXPKRVHYIO-CKBJTTGDSA-N |
| XLogP | 5.47 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|