C13H19NO8S — CID 44568232
[(3R,4R,5S,6S)-4,5-diacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl] acetate (PubChem CID 44568232) has the molecular formula C13H19NO8S and a molecular weight of 349.36 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 44568232 |
| Molecular Formula | C13H19NO8S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@H](SCC(N)=O)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H19NO8S/c1-6(15)20-9-4-19-13(23-5-10(14)18)12(22-8(3)17)11(9)21-7(2)16/h9,11-13H,4-5H2,1-3H3,(H2,14,18)/t9-,11-,12+,13+/m1/s1 |
| InChIKey | PLSZOXAUQRSDSI-XEZLXBQYSA-N |
| XLogP | -0.64 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|