C28H39NO18S — CID 44568234
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 44568234) has the molecular formula C28H39NO18S and a molecular weight of 709.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44568234 |
| Molecular Formula | C28H39NO18S |
| Molecular Weight | 709.68 g/mol |
| Exact Mass | 709.19 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(2-amino-2-oxoethyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCC(N)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H39NO18S/c1-11(30)38-8-18-21(40-13(3)32)23(41-14(4)33)25(43-16(6)35)27(45-18)47-22-19(9-39-12(2)31)46-28(48-10-20(29)37)26(44-17(7)36)24(22)42-15(5)34/h18-19,21-28H,8-10H2,1-7H3,(H2,29,37)/t18-,19-,21-,22-,23+,24+,25-,26-,27+,28+/m1/s1 |
| InChIKey | FQWXRBLFLZUWJG-ISOVRWNUSA-N |
| XLogP | -1.18 |
| TPSA | 254.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.68 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|