C16H23NO10S — CID 44568266
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 44568266) has the molecular formula C16H23NO10S and a molecular weight of 421.42 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44568266 |
| Molecular Formula | C16H23NO10S |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(2-amino-2-oxoethyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCC(N)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H23NO10S/c1-7(18)23-5-11-13(24-8(2)19)14(25-9(3)20)15(26-10(4)21)16(27-11)28-6-12(17)22/h11,13-16H,5-6H2,1-4H3,(H2,17,22)/t11-,13-,14+,15+,16+/m1/s1 |
| InChIKey | KQIQGAYZDZVMJV-VMMWWAARSA-N |
| XLogP | -0.71 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|