C18H25N3O — CID 44568286
3-(7-methoxy-1-methyl-3,4-dihydropyrido[3,4-b]indol-9-yl)-N,N-dimethylpropan-1-amine (PubChem CID 44568286) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-(7-methoxy-1-methyl-3,4-dihydropyrido[3,4-b]indol-9-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(7-methoxy-1-methyl-3,4-dihydropyrido[3,4-b]indol-9-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 44568286 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 3-(7-methoxy-1-methyl-3,4-dihydropyrido[3,4-b]indol-9-yl)-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc2c3c(n(CCCN(C)C)c2c1)C(C)=NCC3 |
| InChI | InChI=1S/C18H25N3O/c1-13-18-16(8-9-19-13)15-7-6-14(22-4)12-17(15)21(18)11-5-10-20(2)3/h6-7,12H,5,8-11H2,1-4H3 |
| InChIKey | VUKPSBWDTNCHJB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|