About [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone
[4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 44568353) has the molecular formula C25H29N3O
and a molecular weight of 387.53 g/mol. Its IUPAC name is [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 44568353 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1cc(C)cc(N(Cc2ccccc2)c2cc(C(=O)N3CCCC3)n(C)c2)c1 |
| InChI | InChI=1S/C25H29N3O/c1-19-13-20(2)15-22(14-19)28(17-21-9-5-4-6-10-21)23-16-24(26(3)18-23)25(29)27-11-7-8-12-27/h4-6,9-10,13-16,18H,7-8,11-12,17H2,1-3H3 |
| InChIKey | ZGUPKATVJOESLB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone (CID 44568353) is [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone is Cc1cc(C)cc(N(Cc2ccccc2)c2cc(C(=O)N3CCCC3)n(C)c2)c1.
What is the InChIKey of [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is ZGUPKATVJOESLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O/c1-19-13-20(2)15-22(14-19)28(17-21-9-5-4-6-10-21)23-16-24(26(3)18-23)25(29)27-11-7-8-12-27/h4-6,9-10,13-16,18H,7-8,11-12,17H2,1-3H3.
What are the key properties of [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone?
[4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 387.53 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(N-benzyl-3,5-dimethylanilino)-1-methylpyrrol-2-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 44568353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).