C12H16INO3 — CID 44568502
(2R,3R,4S)-2-(hydroxymethyl)-1-[(4-iodophenyl)methyl]pyrrolidine-3,4-diol (PubChem CID 44568502) has the molecular formula C12H16INO3 and a molecular weight of 349.17 g/mol. Its IUPAC name is (2R,3R,4S)-2-(hydroxymethyl)-1-[(4-iodophenyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(hydroxymethyl)-1-[(4-iodophenyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 44568502 |
| Molecular Formula | C12H16INO3 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | (2R,3R,4S)-2-(hydroxymethyl)-1-[(4-iodophenyl)methyl]pyrrolidine-3,4-diol |
| SMILES | OC[C@@H]1[C@@H](O)[C@@H](O)CN1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C12H16INO3/c13-9-3-1-8(2-4-9)5-14-6-11(16)12(17)10(14)7-15/h1-4,10-12,15-17H,5-7H2/t10-,11+,12-/m1/s1 |
| InChIKey | NSQLXDMHOXNTHG-GRYCIOLGSA-N |
| XLogP | 0.19 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|